1-[(2,4-dimethylanilino)methylidene]naphthalen-2-one structure
|
Common Name | 1-[(2,4-dimethylanilino)methylidene]naphthalen-2-one | ||
|---|---|---|---|---|
| CAS Number | 63623-47-2 | Molecular Weight | 275.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2,4-dimethylanilino)methylidene]naphthalen-2-one |
|---|
| Molecular Formula | C19H17NO |
|---|---|
| Molecular Weight | 275.34400 |
| Exact Mass | 275.13100 |
| PSA | 29.10000 |
| LogP | 4.42530 |
| InChIKey | OXXMQKOVIVAAJR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Cc2c(O)ccc3ccccc23)c(C)c1 |
|
~%
1-[(2,4-dimethy... CAS#:63623-47-2 |
| Literature: Senier; Clarke Journal of the Chemical Society, 1911 , vol. 99, p. 2082 |