2,4-Dimethoxybenzenesulfonyl chloride structure
|
Common Name | 2,4-Dimethoxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 63624-28-2 | Molecular Weight | 236.673 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 363.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H9ClO4S | Melting Point | 69-71 °C | |
| MSDS | Chinese USA | Flash Point | 173.7±23.7 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2,4-Dimethoxybenzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.6±27.0 °C at 760 mmHg |
| Melting Point | 69-71 °C |
| Molecular Formula | C8H9ClO4S |
| Molecular Weight | 236.673 |
| Flash Point | 173.7±23.7 °C |
| Exact Mass | 235.991013 |
| PSA | 60.98000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | AYGZKRRIULCJKC-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Cl)c(OC)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Phrases | R34 |
| Safety Phrases | S45-S36/37/39-S3-S26 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2909309090 |
|
~%
2,4-Dimethoxybe... CAS#:63624-28-2 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 603 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzenesulfonyl chloride, 2,4-dimethoxy- |
| MFCD00060683 |
| 2,4-Dimethoxybenzenesulfonyl chloride |