methyl 1-chloro-9,10-dioxo-9,10-dihydroanthracene-2-carboxylate structure
|
Common Name | methyl 1-chloro-9,10-dioxo-9,10-dihydroanthracene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6363-92-4 | Molecular Weight | 300.69300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H9ClO4 |
|---|---|
| Molecular Weight | 300.69300 |
| Exact Mass | 300.01900 |
| PSA | 60.44000 |
| LogP | 2.90200 |
| InChIKey | QDGMEEFDBWQAQU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| HS Code | 2918300090 |
|---|
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: Ullmann; Bincer Chemische Berichte, 1916 , vol. 49, p. 740 |
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: Ullmann; Bincer Chemische Berichte, 1916 , vol. 49, p. 740 |
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: Ullmann; Bincer Chemische Berichte, 1916 , vol. 49, p. 740 |
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: Ullmann; Bincer Chemische Berichte, 1916 , vol. 49, p. 740 |
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: Ullmann; Bincer Chemische Berichte, 1916 , vol. 49, p. 740 |
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: Ullmann; Bincer Chemische Berichte, 1916 , vol. 49, p. 740 |
|
~%
methyl 1-chloro... CAS#:6363-92-4 |
| Literature: I.G. Farbenind. Patent: DE609401 , 1932 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 21, p. 1031 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-Chlor-anthrachinon-2-carbonsaeure-methylester |
| 1-chloro-9,10-dioxo-9,10-dihydro-anthracene-2-carboxylic acid methyl ester |
| methyl 1-chloro-9,10-dioxo-9,10-dihydroanthracene-2-carboxylate |
| 1-Chlor-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure-methylester |