2-Anthracenecarboxylicacid, 1-chloro-9,10-dihydro-9,10-dioxo structure
|
Common Name | 2-Anthracenecarboxylicacid, 1-chloro-9,10-dihydro-9,10-dioxo | ||
|---|---|---|---|---|
| CAS Number | 82-23-5 | Molecular Weight | 286.66700 | |
| Density | 1.561g/cm3 | Boiling Point | 551.5ºC at 760 mmHg | |
| Molecular Formula | C15H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.3ºC | |
| Name | 1-chloro-9,10-dioxo-9,10-dihydroanthracene-2-carboxylicacid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.561g/cm3 |
|---|---|
| Boiling Point | 551.5ºC at 760 mmHg |
| Molecular Formula | C15H7ClO4 |
| Molecular Weight | 286.66700 |
| Flash Point | 287.3ºC |
| Exact Mass | 286.00300 |
| PSA | 71.44000 |
| LogP | 2.81360 |
| Index of Refraction | 1.694 |
| InChIKey | ZHLRCPOFSPCJPL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| HS Code | 2918300090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-Chlor-2-carboxy-anthrachinon |
| 1-chloro-9,10-dioxo-9,10-dihydro-anthracene-2-carboxylic acid |
| 1-Chlor-anthrachinon-carbonsaeure-(2)-chlorid |
| 1-Chlor-9,10-dioxo-9,10-dihydro-anthracen-2-carbonylchlorid |
| 1-chloroanthraquinone-2-carboxylic acid |
| 1-chloroanthraquinone-2-carboxylic acid chloride |
| 1-Chlor-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure |
| 1-chloro-9,10-dioxo-9,10-dihydroanthracene-2-carbonyl chloride |
| 1-Chlor-anthrachinon-carbonsaeure-(2) |