Ethyl 2-(4-benzyloxyphenoxy)propionate structure
|
Common Name | Ethyl 2-(4-benzyloxyphenoxy)propionate | ||
|---|---|---|---|---|
| CAS Number | 63650-08-8 | Molecular Weight | 300.34900 | |
| Density | 1.12g/cm3 | Boiling Point | 417.9ºC at 760 mmHg | |
| Molecular Formula | C18H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | Ethyl 2-(4-benzyloxyphenoxy)propionate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 417.9ºC at 760 mmHg |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.34900 |
| Flash Point | 182.9ºC |
| Exact Mass | 300.13600 |
| PSA | 44.76000 |
| LogP | 3.59600 |
| Index of Refraction | 1.542 |
| InChIKey | LMKYBAPDSOHWRD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccc(OCc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~89%
Ethyl 2-(4-benz... CAS#:63650-08-8 |
| Literature: Kato, Dai-Ichiro; Mitsuda, Satoshi; Ohta, Hiromichi Journal of Organic Chemistry, 2003 , vol. 68, # 19 p. 7234 - 7242 |
|
~%
Ethyl 2-(4-benz... CAS#:63650-08-8 |
| Literature: Nissan Chemical Industries Ltd. Patent: US4537984 A1, 1985 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 2-[4'-(4"-tetrahydropyranyl)-phenoxy]-propanoate |
| 2-(4-benzyloxyphenoxy)propionic acid ethyl ester |
| (+)-ethyl 2-(4-benzyloxyphenoxy)propionate |
| Propanoic acid,2-[4-(tetrahydro-2H-pyran-4-yl)phenoxy]-,ethyl ester |
| ethyl 2-[p-(4-tetrahydropyranyl)-phenoxy]-propanoate |
| ethyl 2-[p-(benzyloxy)phenoxy]propionate |
| ethyl 2-(4-benzyloxyphenoxy)propanoate |