n-α-acetyl-n-ε-z-l-lysine structure
|
Common Name | n-α-acetyl-n-ε-z-l-lysine | ||
|---|---|---|---|---|
| CAS Number | 6367-08-4 | Molecular Weight | 322.35600 | |
| Density | 1.204g/cm3 | Boiling Point | 612.4ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.1ºC | |
| Name | 2-acetamido-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 612.4ºC at 760 mmHg |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.35600 |
| Flash Point | 324.1ºC |
| Exact Mass | 322.15300 |
| PSA | 104.73000 |
| LogP | 2.45420 |
| Index of Refraction | 1.535 |
| InChIKey | JYUVJQBGBKAJMS-AWEZNQCLSA-N |
| SMILES | CC(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)O |
|
~84%
n-α-acetyl-n-ε-... CAS#:6367-08-4 |
| Literature: Soejima; Akagi; Izumiya Chemical and Pharmaceutical Bulletin, 1994 , vol. 42, # 12 p. 2618 - 2620 |
|
~%
n-α-acetyl-n-ε-... CAS#:6367-08-4 |
| Literature: Neuberger; Sanger Biochemical Journal, 1943 , vol. 37, p. 515 |
|
~%
n-α-acetyl-n-ε-... CAS#:6367-08-4 |
| Literature: Moll; Stauff Archiv der Pharmazie, 1985 , vol. 318, # 2 p. 120 - 127 |
|
~%
n-α-acetyl-n-ε-... CAS#:6367-08-4 |
| Literature: Moll; Stauff Archiv der Pharmazie, 1985 , vol. 318, # 2 p. 120 - 127 |
| N~2~-Acetyl-N~6~-((benzyloxy)carbonyl)lysine |
| 2-(acetylamino)-6-{[(benzyloxy)carbonyl]amino}hexanoic acid |