Benzamide,N,N'-(9,10-dihydro-4-hydroxy-9,10-dioxo-1,5-anthracenediyl)bis- structure
|
Common Name | Benzamide,N,N'-(9,10-dihydro-4-hydroxy-9,10-dioxo-1,5-anthracenediyl)bis- | ||
|---|---|---|---|---|
| CAS Number | 6370-96-3 | Molecular Weight | 462.45300 | |
| Density | 1.466g/cm3 | Boiling Point | 580.2ºC at 760 mmHg | |
| Molecular Formula | C28H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.7ºC | |
| Name | N-(5-benzamido-4-hydroxy-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 580.2ºC at 760 mmHg |
| Molecular Formula | C28H18N2O5 |
| Molecular Weight | 462.45300 |
| Flash Point | 304.7ºC |
| Exact Mass | 462.12200 |
| PSA | 112.57000 |
| LogP | 4.81820 |
| Index of Refraction | 1.759 |
| InChIKey | GLIQRROTAUIWKA-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2c1C(=O)c1c(O)ccc(NC(=O)c3ccccc3)c1C2=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,N,N'-... CAS#:6370-96-3 |
| Literature: Bayer and Co. Patent: DE238488 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 646 |
|
~%
Benzamide,N,N'-... CAS#:6370-96-3 |
| Literature: Bayer and Co. Patent: DE213500 ; Full Text Show Details Bayer and Co. Patent: DE238488 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 646 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Algol Red BK |
| Ponsol Red AFF |
| Algol Brilliant Red 2B |
| C.I. Pigment Red 85 |
| Algol Brilliant Red BB |
| Algol Pink BBK |
| n,n'-(4-hydroxy-9,10-dioxo-9,10-dihydroanthracene-1,5-diyl)dibenzamide |
| Indo Red MV-6640 |