1,5-DIBENZAMIDOANTHRAQUINONE structure
|
Common Name | 1,5-DIBENZAMIDOANTHRAQUINONE | ||
|---|---|---|---|---|
| CAS Number | 82-18-8 | Molecular Weight | 446.45400 | |
| Density | 1.409 g/cm3 | Boiling Point | 556.3ºC at 760 mmHg | |
| Molecular Formula | C28H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | N-(5-benzamido-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409 g/cm3 |
|---|---|
| Boiling Point | 556.3ºC at 760 mmHg |
| Molecular Formula | C28H18N2O4 |
| Molecular Weight | 446.45400 |
| Flash Point | 159.5ºC |
| Exact Mass | 446.12700 |
| PSA | 92.34000 |
| LogP | 5.11260 |
| Index of Refraction | 1.74 |
| InChIKey | PZNXLZZWWBSQQK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2c1C(=O)c1cccc(NC(=O)c3ccccc3)c1C2=O)c1ccccc1 |
|
~%
1,5-DIBENZAMIDO... CAS#:82-18-8 |
| Literature: Noelting; Wortmann Chemische Berichte, 1906 , vol. 39, p. 642 |
|
~%
1,5-DIBENZAMIDO... CAS#:82-18-8 |
| Literature: British Dyestuffs Corp., Perkin, Bunbury Patent: DE462053 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1263 |
|
~%
1,5-DIBENZAMIDO... CAS#:82-18-8 |
| Literature: Noelting; Wortmann Chemische Berichte, 1906 , vol. 39, p. 642 |
|
~%
1,5-DIBENZAMIDO... CAS#:82-18-8 |
| Literature: I. G. Farbenind. Patent: DE696423 , 1935 ; DRP/DRBP Org.Chem. |
|
~%
1,5-DIBENZAMIDO... CAS#:82-18-8 |
| Literature: Du Pont de Nemours and Co. Patent: US2346726 , 1942 ; |
| 1.5-Bis-benzamino-anthrachinon |
| Indanthrengelb GK |
| 1,5-bis-benzoylamino-anthraquinone |
| Solanthrene Yellow 3J |
| N,N'-(9,10-dihydro-9,10-dioxo-1,5-anthracenediyl) |
| 1,5-dibenzoylaminoanthraquinone |
| 1,5-Bis-benzoylamino-anthrachinon |
| Ponsol Yellow ARD |
| Endurol Yellow 3G |
| Mikethrene Yellow GK |
| 1,5-Dibenzamidoanthraquinone |
| Ponsol Yellow AR |
| N,N'-(9,10-dihydro-9,10-dioxoanthracene-1,5-diyl)bisbenzamide |
| Nyanthrene Yellow AR |
| Vat Yellow 3 |
| Indanthren Yellow GK |
| Cibanone Yellow FGK |