1-amino-4,5,8-trihydroxyanthraquinone structure
|
Common Name | 1-amino-4,5,8-trihydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 6374-78-3 | Molecular Weight | 271.22500 | |
| Density | 1.731g/cm3 | Boiling Point | 601.6ºC at 760 mmHg | |
| Molecular Formula | C14H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.6ºC | |
| Name | 1-amino-4,5,8-trihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.731g/cm3 |
|---|---|
| Boiling Point | 601.6ºC at 760 mmHg |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.22500 |
| Flash Point | 317.6ºC |
| Exact Mass | 271.04800 |
| PSA | 120.85000 |
| LogP | 1.74220 |
| Index of Refraction | 1.826 |
| InChIKey | XOWIUAITUCBCNN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
1-amino-4,5,8-t... CAS#:6374-78-3 |
| Literature: I. G. Farbenind. Patent: DE556459 , 1930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 1954 |
|
~%
1-amino-4,5,8-t... CAS#:6374-78-3 |
| Literature: I. G. Farbenind. Patent: DE554647 , 1930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 1949 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 228-927-8 |
| 1-Amino-4,5,8-trihydroxyanthraquinone |
| 1-amino-4,5,8-trihydroxy-9,10-anthraquinone |