2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide
![2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide Structure](https://image.chemsrc.com/caspic/087/6374-84-1.png)
2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide structure
|
Common Name | 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 6374-84-1 | Molecular Weight | 365.46900 | |
| Density | 1.14g/cm3 | Boiling Point | 581.9ºC at 760mmHg | |
| Molecular Formula | C22H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 581.9ºC at 760mmHg |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.46900 |
| Flash Point | 305.7ºC |
| Exact Mass | 365.21000 |
| PSA | 56.14000 |
| LogP | 2.94180 |
| Index of Refraction | 1.584 |
| InChIKey | MZVFDTIYUFIGJT-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)NCCN1CCN(C(=O)c2ccccc2C)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Bayer and Co. Patent: DE288825 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 414 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Chamberlin Synthetic Communications, 1995 , vol. 25, # 1 p. 27 - 31 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Bayer and Co. Patent: DE236604 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 581 |
|
~%
2-methyl-N-[2-[... CAS#:6374-84-1 |
| Literature: Bayer and Co. Patent: DE236604 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 581 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: Polar surface area (PSA) of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is 56.14000. |
| Q: What is the CAS number of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: CAS number of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is 6374-84-1. |
| Q: What is the molecular formula of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: Molecular formula of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is C22H27N3O2. |
| Q: What is the SMILES notation of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: SMILES notation of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is Cc1ccccc1C(=O)NCCN1CCN(C(=O)c2ccccc2C)CC1. |
| Q: What is the Chinese name of 6374-84-1? |
| A: Chinese name of 6374-84-1 is 6374-84-1. |
| Q: What is the molecular weight of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: Molecular weight of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is 365.46900. |
| Q: What is the English name of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: The English name of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide. |
| Q: What is the LogP of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: LogP of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is 2.94180. |
| Q: What is the InChIKey of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: InChIKey of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is MZVFDTIYUFIGJT-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide? |
| A: Boiling point of 2-methyl-N-[2-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]benzamide is 581.9ºC at 760mmHg. |