1-Bromo-4-methylaminoanthraquinone structure
|
Common Name | 1-Bromo-4-methylaminoanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 128-93-8 | Molecular Weight | 316.149 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 510.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H10BrNO2 | Melting Point | 195.5°C | |
| MSDS | N/A | Flash Point | 262.3±30.1 °C | |
| Name | 1-bromo-4-(methylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.1±50.0 °C at 760 mmHg |
| Melting Point | 195.5°C |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.149 |
| Flash Point | 262.3±30.1 °C |
| Exact Mass | 314.989471 |
| PSA | 46.17000 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | IIPRUQZTMZETSL-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Br)c2c1C(=O)c1ccccc1C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi,C |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R34:Causes burns. |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 2927 |
| HS Code | 2922399090 |
|
~%
1-Bromo-4-methy... CAS#:128-93-8 |
| Literature: DE164791 ; US2459149 , ; |
|
~%
1-Bromo-4-methy... CAS#:128-93-8 |
| Literature: DE144634 ; |
|
~%
1-Bromo-4-methy... CAS#:128-93-8
Learn More
|
| Literature: Synthetic Communications, , vol. 25, # 1 p. 27 - 31 |
|
~%
1-Bromo-4-methy... CAS#:128-93-8 |
| Literature: US2459149 , ; |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-bromo-4-(methylamino)-9,10-anthracenedione |
| 4-Bromo-1-(methylamino)anthraquinone |
| EINECS 204-920-5 |
| 1-Bromo-4-(methylamino)-9,10-anthraquinone |
| 1-(Methylamino)-4-bromoanthraquinone |
| MFCD00035691 |
| 1-Methylamino-4-bromanthrachinon |
| 1-Bromo-4-methylaminoanthraquinone |
| ANTHRAQUINONE,1-BROMO-4-(METHYLAMINO) |
| 1-Brom-4-methylamino-anthrachinon |
| 4-bromo-1-methylaminoanthraquinone |
| 1-Bromo-4-methylamino-anthraquinone |