5-amino-4-methoxy-2-nitrobenzenesulfonic acid structure
|
Common Name | 5-amino-4-methoxy-2-nitrobenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6375-05-9 | Molecular Weight | 248.21300 | |
| Density | 1.651g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-4-methoxy-2-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.651g/cm3 |
|---|---|
| Molecular Formula | C7H8N2O6S |
| Molecular Weight | 248.21300 |
| Exact Mass | 248.01000 |
| PSA | 143.82000 |
| LogP | 2.61750 |
| Index of Refraction | 1.624 |
| InChIKey | QQSSZTDQUIRFNT-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(S(=O)(=O)O)cc1N |
| HS Code | 2922199090 |
|---|
|
~63%
5-amino-4-metho... CAS#:6375-05-9 |
| Literature: Paull, Keneth D.; Shoemaker, Robert H.; Boyd, Michael R.; Parsons, Jack L.; Risbood, Prabhakar A.; et al. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 911 - 914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 228-930-4 |