5-amino-4-methoxy-2-nitrobenzenesulfonic acid
Modify Date: 2026-07-26 16:11:57
5-amino-4-methoxy-2-nitrobenzenesulfonic acid structure
|
Common Name | 5-amino-4-methoxy-2-nitrobenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6375-05-9 | Molecular Weight | 248.21300 | |
| Density | 1.651g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-4-methoxy-2-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.651g/cm3 |
|---|---|
| Molecular Formula | C7H8N2O6S |
| Molecular Weight | 248.21300 |
| Exact Mass | 248.01000 |
| PSA | 143.82000 |
| LogP | 2.61750 |
| Index of Refraction | 1.624 |
| InChIKey | QQSSZTDQUIRFNT-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(S(=O)(=O)O)cc1N |
| HS Code | 2922199090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 3, Current Page 1 of 1
1
| einecs 228-930-4 |