5-amino-4-methoxy-2-(4-amino-5-methoxy-2-sulfophenyl)benzenesulfonic acid structure
|
Common Name | 5-amino-4-methoxy-2-(4-amino-5-methoxy-2-sulfophenyl)benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6404-70-2 | Molecular Weight | 404.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-2-(4-amino-5-methoxy-2-sulfophenyl)-4-methoxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O8S2 |
|---|---|
| Molecular Weight | 404.41500 |
| Exact Mass | 404.03500 |
| PSA | 196.00000 |
| LogP | 4.35260 |
| InChIKey | OUBHDMWPBMOFIT-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(OC)c(N)cc2S(=O)(=O)O)c(S(=O)(=O)O)cc1N |
| HS Code | 2922299090 |
|---|
|
~%
5-amino-4-metho... CAS#:6404-70-2 |
| Literature: Akt.-Ges. f. Anilinf. Patent: DE172106 ; |
|
~%
5-amino-4-metho... CAS#:6404-70-2 |
| Literature: Akt.-Ges. f. Anilin-Fabr. Patent: DE172106 ; |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o-Dianisidin-disulfonsaeure |
| 4,4'-Diamino-5,5'-dimethoxy-biphenyl-2,2'-disulfonsaeure |
| 4,4'-diamino-5,5'-dimethoxy-biphenyl-2,2'-disulfonic acid |