12alpha-Hydroxykaura-9(11),16-dien-18-oic acid structure
|
Common Name | 12alpha-Hydroxykaura-9(11),16-dien-18-oic acid | ||
|---|---|---|---|---|
| CAS Number | 63768-17-2 | Molecular Weight | 316.43 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 495.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.4±25.2 °C | |
Use of 12alpha-Hydroxykaura-9(11),16-dien-18-oic acid12α-Hydroxygrandiflorenic acid is a compound isolated from the whole plant of Wedelia chinensis (Osbeck.)[1]. |
| Name | (4R,4aS,6aS,9R,10S,11bR)-10-hydroxy-4,11b-dimethyl-8-methylene-1,2,3,4,4a,5,6,7,8,9,10,11b-dodecahydro-6a,9-methanocyclohepta[a]naphthalene-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 12α-Hydroxygrandiflorenic acid is a compound isolated from the whole plant of Wedelia chinensis (Osbeck.)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.2±45.0 °C at 760 mmHg |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.43 |
| Flash Point | 267.4±25.2 °C |
| Exact Mass | 316.203857 |
| PSA | 57.53000 |
| LogP | 4.29 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | YKLRBAUBANVECM-SUIOEDAWSA-N |
| SMILES | C=C1CC23CCC4C(C)(C(=O)O)CCCC4(C)C2=CC(O)C1C3 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| (5β,8α,10α,12α,13α)-12-Hydroxykaura-9(11),16-dien-18-oic acid |