Z-D-ARG-OH structure
|
Common Name | Z-D-ARG-OH | ||
|---|---|---|---|---|
| CAS Number | 6382-93-0 | Molecular Weight | 308.333 | |
| Density | 1.33 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H20N4O4 | Melting Point | 168-171ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-D-ARG-OHZ-D-Arg-OH is an arginine derivative[1]. |
| Name | (2R)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-D-Arg-OH is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.33 g/cm3 |
|---|---|
| Melting Point | 168-171ºC |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.333 |
| Exact Mass | 308.148468 |
| PSA | 137.53000 |
| LogP | 1.11 |
| Index of Refraction | 8 ° (C=5.5, HCl) |
| InChIKey | SJSSFUMSAFMFNM-LLVKDONJSA-N |
| SMILES | NC(N)=NCCCC(NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | -20°C |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Nalpha-Carbobenzyloxy-D-arginine |
| N-[(Benzyloxy)carbonyl]-D-arginine |
| N|A-Z-D-arginine |
| Benzene, [[[[[(1R)-1-carboxy-4-[(diaminomethylene)ammonio]butyl]amino]carbonyl]oxy]methyl]-, inner salt |
| Nalpha-Carbobenzoxy-D-arginine |
| Nalpha-Cbz-D-arginine |
| Benzyloxycarbonylarginine |
| (2R)-2-{[(Benzyloxy)carbonyl]amino}-5-[(diaminomethylene)ammonio]pentanoate |
| Cbz-D-Arginine |
| MFCD00063009 |
| Z-D-Arg-OH |