Thiosulfuric acid,anhydride with phenylmethyl carbonothioate, sodium salt (1:1) structure
|
Common Name | Thiosulfuric acid,anhydride with phenylmethyl carbonothioate, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 63842-04-6 | Molecular Weight | 271.26600 | |
| Density | 1.569g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H8NaO5S2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,sulfosulfanylcarbonyloxymethylbenzene |
|---|
| Density | 1.569g/cm3 |
|---|---|
| Molecular Formula | C8H8NaO5S2+ |
| Molecular Weight | 271.26600 |
| Exact Mass | 270.97100 |
| PSA | 114.35000 |
| LogP | 2.94000 |
| Index of Refraction | 1.629 |
| InChIKey | IJJHWLZCAZIABI-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)SS(=O)(=O)O.[Na+] |