13-Oxopodocarp-8(14)-en-15-oic acid structure
|
Common Name | 13-Oxopodocarp-8(14)-en-15-oic acid | ||
|---|---|---|---|---|
| CAS Number | 63976-69-2 | Molecular Weight | 276.37 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 444.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.7±25.2 °C | |
Use of 13-Oxopodocarp-8(14)-en-15-oic acid13-Keto-8(14)-Podocarpen-18-oic acid (compound 16) is a compound isolated from Pinus massoniana Lamb[1]. |
| Name | 13-Oxopodocarp-8(14)-en-18-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 13-Keto-8(14)-Podocarpen-18-oic acid (compound 16) is a compound isolated from Pinus massoniana Lamb[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.4±45.0 °C at 760 mmHg |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.37 |
| Flash Point | 236.7±25.2 °C |
| Exact Mass | 276.172546 |
| PSA | 54.37000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | DXXGHDAWCPTRPU-XRIDFMPVSA-N |
| SMILES | CC1(C(=O)O)CCCC2(C)C3CCC(=O)C=C3CCC12 |
| Hazard Codes | Xi |
|---|
| 13-Oxopodocarp-8(14)-en-15-oic acid |
| 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a-dimethyl-7-oxo-, (1R,4aR,4bS,10aR)- |