3-Methyl-8-(3-phenylacryloyl)-3,8-diazabicyclo[3.2.1]octane structure
|
Common Name | 3-Methyl-8-(3-phenylacryloyl)-3,8-diazabicyclo[3.2.1]octane | ||
|---|---|---|---|---|
| CAS Number | 63977-92-4 | Molecular Weight | 256.34300 | |
| Density | 1.138g/cm3 | Boiling Point | 435.4ºC at 760mmHg | |
| Molecular Formula | C16H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | (E)-1-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-3-phenylprop-2-en-1-one |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 435.4ºC at 760mmHg |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.34300 |
| Flash Point | 195.8ºC |
| Exact Mass | 256.15800 |
| PSA | 23.55000 |
| LogP | 1.88060 |
| Index of Refraction | 1.605 |
| InChIKey | KORVTMHAROWYHH-UHFFFAOYSA-N |
| SMILES | CN1CC2CCC(C1)N2C(=O)C=Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |