1-(3,4-Dimethoxybenzyl)-4-(4-pyridinyl)piperazine structure
|
Common Name | 1-(3,4-Dimethoxybenzyl)-4-(4-pyridinyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 63978-41-6 | Molecular Weight | 313.39400 | |
| Density | 1.15g/cm3 | Boiling Point | 453.3ºC at 760mmHg | |
| Molecular Formula | C18H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-pyridin-4-ylpiperazine |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 453.3ºC at 760mmHg |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.39400 |
| Flash Point | 227.9ºC |
| Exact Mass | 313.17900 |
| PSA | 37.83000 |
| LogP | 2.42390 |
| Index of Refraction | 1.58 |
| InChIKey | YKYZDYLMCQJLIB-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CCN(c3ccncc3)CC2)cc1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |