WAY-243197-A structure
|
Common Name | WAY-243197-A | ||
|---|---|---|---|---|
| CAS Number | 428850-59-3 | Molecular Weight | 426.53 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 585.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H26N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.9±32.9 °C | |
Use of WAY-243197-Amodulating T-cells |
| Name | WAY-243197-A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 585.5±60.0 °C at 760 mmHg |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.53 |
| Flash Point | 307.9±32.9 °C |
| Exact Mass | 426.161316 |
| LogP | 4.03 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | HQIKFNXTNYAOQI-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cc1OC |
| 1-(3,4-Dimethoxybenzyl)-4-(2-naphthylsulfonyl)piperazine |
| 1-(3,4-Dimethoxy-benzyl)-4-(naphthalene-2-sulfonyl)-piperazine |
| Piperazine, 1-[(3,4-dimethoxyphenyl)methyl]-4-(2-naphthalenylsulfonyl)- |