3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanoyl chloride structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 64018-26-4 | Molecular Weight | 596.56300 | |
| Density | 1.704g/cm3 | Boiling Point | 226.7ºC at 760 mmHg | |
| Molecular Formula | C12H2ClF21O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.9ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.704g/cm3 |
|---|---|
| Boiling Point | 226.7ºC at 760 mmHg |
| Molecular Formula | C12H2ClF21O |
| Molecular Weight | 596.56300 |
| Flash Point | 90.9ºC |
| Exact Mass | 595.94600 |
| PSA | 17.07000 |
| LogP | 7.42190 |
| Index of Refraction | 1.3 |
| InChIKey | DYTUUAFTUFQJQV-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~75%
3,3,4,4,5,5,6,6... CAS#:64018-26-4 |
| Literature: Achilefu, Samuel; Mansuy, Laurence; Selve, Claude; Thiebaut, Sylvie Journal of Fluorine Chemistry, 1995 , vol. 70, # 1 p. 19 - 26 |
|
~%
3,3,4,4,5,5,6,6... CAS#:64018-26-4 |
| Literature: Achilefu, Samuel; Mansuy, Laurence; Selve, Claude; Thiebaut, Sylvie Journal of Fluorine Chemistry, 1995 , vol. 70, # 1 p. 19 - 26 |
| 2-perfluorodecyl ethanoyl chloride |
| EINECS 264-607-4 |
| Dodecanoyl chloride,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro |
| a,a-Dihydroperfluorododecanoyl chloride |