1,1,2,2-Tetrahydroperfluoro dodecanol structure
|
Common Name | 1,1,2,2-Tetrahydroperfluoro dodecanol | ||
|---|---|---|---|---|
| CAS Number | 865-86-1 | Molecular Weight | 564.13400 | |
| Density | 1.664g/cm3 | Boiling Point | 145 °C | |
| Molecular Formula | C12H5F21O | Melting Point | 95 °C | |
| MSDS | N/A | Flash Point | 145°C/10mm | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.664g/cm3 |
|---|---|
| Boiling Point | 145 °C |
| Melting Point | 95 °C |
| Molecular Formula | C12H5F21O |
| Molecular Weight | 564.13400 |
| Flash Point | 145°C/10mm |
| Exact Mass | 564.00100 |
| PSA | 20.23000 |
| LogP | 6.64880 |
| Index of Refraction | 1.294 |
| InChIKey | FLXYIZWPNQYPIT-UHFFFAOYSA-N |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2905590090 |
|
~%
Detail
|
| Literature: EP1757574 A1, ; Page/Page column 9 ; |
|
~86%
1,1,2,2-Tetrahy... CAS#:865-86-1 |
| Literature: Paterova, Jana; Skalicky, Martin; Rybackova, Marketa; Kvicalova, Magdalena; Cvacka, Josef; Kvicala, Jaroslav Journal of Fluorine Chemistry, 2010 , vol. 131, # 12 p. 1338 - 1343 |
|
~%
1,1,2,2-Tetrahy... CAS#:865-86-1 |
| Literature: EP1757577 A1, ; Page/Page column 7 ; |
|
~%
1,1,2,2-Tetrahy... CAS#:865-86-1
Detail
|
| Literature: EP1757578 A1, ; Page/Page column 7-8 ; |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| perfluorodecylethanol |
| 1-Dodecanol,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro |
| 1H,1H,2H,2H-Perfluorododecan-1-ol |
| EINECS 212-748-7 |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Henicosafluorododecanol |
| 1,1,2,2-Tetrahydrohenicosafluorododecanol |
| 1H,1H,2H,2H-2-perfluorododecanol |
| 2-(perfluorodecyl)ethanol |
| 1H,1H,2H,2H-perfluorododecanol |
| 1,1,2,2-Tetrahydroperfluoro dodecanol |
| MFCD00039545 |
| 12,12,12,11,11,10,10,9,9,8,8,7,7,6,6,5,5,4,4,3,3-heneicosafluorododecan-1-ol |