trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide
![trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide Structure](https://image.chemsrc.com/caspic/130/64050-97-1.png)
trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide structure
|
Common Name | trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide | ||
|---|---|---|---|---|
| CAS Number | 64050-97-1 | Molecular Weight | 521.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25I2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium, diiodide (CAS: 64050-97-1), molecular formula C14H25I2N3O2, molecular weight 521.17600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25I2N3O2 |
|---|---|
| Molecular Weight | 521.17600 |
| Exact Mass | 521.00400 |
| PSA | 44.65000 |
| InChIKey | FWCRRGJNNQJZKB-UHFFFAOYSA-M |
| SMILES | CNC(=O)Oc1cc([N+](C)(C)C)ccc1[N+](C)(C)C.[I-].[I-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
trimethyl-[2-(m... CAS#:64050-97-1 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| t-1810 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: CAS number of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is 64050-97-1. |
| Q: What is the English name of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: The English name of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide. |
| Q: What is the Chinese name of 64050-97-1? |
| A: Chinese name of 64050-97-1 is 64050-97-1. |
| Q: What is the molecular weight of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: Molecular weight of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is 521.17600. |
| Q: What is the polar surface area (PSA) of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: Polar surface area (PSA) of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is 44.65000. |
| Q: What is the InChIKey of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: InChIKey of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is FWCRRGJNNQJZKB-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: SMILES notation of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is CNC(=O)Oc1cc([N+](C)(C)C)ccc1[N+](C)(C)C.[I-].[I-]. |
| Q: What English synonyms does trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide have? |
| A: English synonyms of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide: t-1810. |
| Q: What is the molecular formula of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide? |
| A: Molecular formula of trimethyl-[2-(methylcarbamoyloxy)-4-(trimethylazaniumyl)phenyl]azanium,diiodide is C14H25I2N3O2. |