trimethyl-[3-[4-(methylcarbamoyloxy)phenyl]propyl]azanium,iodide structure
|
Common Name | trimethyl-[3-[4-(methylcarbamoyloxy)phenyl]propyl]azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 64051-02-1 | Molecular Weight | 378.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[3-[4-(methylcarbamoyloxy)phenyl]propyl]azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H23IN2O2 |
|---|---|
| Molecular Weight | 378.24900 |
| Exact Mass | 378.08000 |
| PSA | 44.65000 |
| LogP | 3.11870 |
| InChIKey | NDIJYYCPTVJSCY-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccc(CCC[N+](C)(C)C)cc1.[I-] |
|
~%
trimethyl-[3-[4... CAS#:64051-02-1 |
| Literature: Davies et al. Journal of the Chemical Society, 1947 , p. 191,196 |
| t-1936 |