6-Bromo-3-nitroimidazo[1,2-a]pyridine structure
|
Common Name | 6-Bromo-3-nitroimidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 64064-71-7 | Molecular Weight | 242.030 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H4BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Bromo-3-nitroimidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C7H4BrN3O2 |
| Molecular Weight | 242.030 |
| Exact Mass | 240.948685 |
| PSA | 63.12000 |
| LogP | 1.98 |
| Index of Refraction | 1.757 |
| InChIKey | UNZUDRAJUWZDNT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc2ccc(Br)cn12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
6-Bromo-3-nitro... CAS#:64064-71-7 |
| Literature: US4096264 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Bromo-3-nitroimidazo[1,2-a]pyridine |
| Imidazo[1,2-a]pyridine, 6-bromo-3-nitro- |