4-hydroxy-3-[(4-nitrophenyl)methylideneamino]benzenesulfonamide
Modify Date: 2025-11-25 11:53:40
![4-hydroxy-3-[(4-nitrophenyl)methylideneamino]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/384/64073-91-2.png)
4-hydroxy-3-[(4-nitrophenyl)methylideneamino]benzenesulfonamide structure
|
Common Name | 4-hydroxy-3-[(4-nitrophenyl)methylideneamino]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 64073-91-2 | Molecular Weight | 321.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-[(4-nitrophenyl)methylideneamino]benzenesulfonamide |
|---|
| Molecular Formula | C13H11N3O5S |
|---|---|
| Molecular Weight | 321.30900 |
| Exact Mass | 321.04200 |
| PSA | 146.95000 |
| LogP | 4.00270 |
| InChIKey | PLUWJCCILXNPKZ-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(O)c(N=Cc2ccc([N+](=O)[O-])cc2)c1 |
|
~%
4-hydroxy-3-[(4... CAS#:64073-91-2 |
| Literature: Stephens; Bower Journal of the Chemical Society, 1950 , p. 1722,1725 |
