1,4-diamino-2,3-dibromoanthraquinone
Modify Date: 2025-09-06 10:10:16
1,4-diamino-2,3-dibromoanthraquinone structure
|
Common Name | 1,4-diamino-2,3-dibromoanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 6409-15-0 | Molecular Weight | 396.03400 | |
| Density | 2.02g/cm3 | Boiling Point | 621.9ºC at 760 mmHg | |
| Molecular Formula | C14H8Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9ºC | |
| Name | 1,4-diamino-2,3-dibromoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 621.9ºC at 760 mmHg |
| Molecular Formula | C14H8Br2N2O2 |
| Molecular Weight | 396.03400 |
| Flash Point | 329.9ºC |
| Exact Mass | 393.89500 |
| PSA | 86.18000 |
| LogP | 4.31380 |
| Index of Refraction | 1.783 |
| InChIKey | WETZVVQTMWRYHU-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)c(Br)c(N)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
1,4-diamino-2,3... CAS#:6409-15-0 |
| Literature: Bayer and Co. Patent: DE158287 ; |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,4-Diamino-2,3-dibrom-anthrachinon |
| EINECS 229-079-1 |
| 1,4-Diamino-2,3-dibromoanthraquinone |
| 1,4-diamino-2,3-dibromo-9,10-anthraquinone |