1,4-diamino-2,3,5-trichlorocyclohexa-2,5-diene-1,4-diol structure
|
Common Name | 1,4-diamino-2,3,5-trichlorocyclohexa-2,5-diene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 87963-51-7 | Molecular Weight | 245.49100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-diamino-2,3,5-trichlorocyclohexa-2,5-diene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7Cl3N2O2 |
|---|---|
| Molecular Weight | 245.49100 |
| Exact Mass | 243.95700 |
| PSA | 92.50000 |
| LogP | 1.50710 |
| InChIKey | VGULYYHKQFZLFG-UHFFFAOYSA-N |
| SMILES | NC1(O)C=C(Cl)C(N)(O)C(Cl)=C1Cl |
|
~%
1,4-diamino-2,3... CAS#:87963-51-7 |
| Literature: Chudek, John A.; Foster, Roy; Reid, Francis J. Journal of the Chemical Society, Chemical Communications, 1983 , # 13 p. 726 - 727 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Cyclohexadiene-1,4-diol,1,4-diamino-2,3,5-trichloro |