1,1',1''-Phosphoryltripyrrolidine structure
|
Common Name | 1,1',1''-Phosphoryltripyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 6415-07-2 | Molecular Weight | 257.312 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.9±9.0 °C at 760 mmHg | |
| Molecular Formula | C12H24N3OP | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 189.6±18.7 °C | |
| Name | Tris(Pyrrolidinophosphine) Oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.9±9.0 °C at 760 mmHg |
| Molecular Formula | C12H24N3OP |
| Molecular Weight | 257.312 |
| Flash Point | 189.6±18.7 °C |
| Exact Mass | 257.165710 |
| PSA | 36.60000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | GQOGEHIVQIMJMO-UHFFFAOYSA-N |
| SMILES | O=P(N1CCCC1)(N1CCCC1)N1CCCC1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
Detail
|
| Literature: US2006/30583 A1, ; Page/Page column 132-133 ; US 20060030583 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Y. Ozari, J. Jagur-Grodzinski
J. Chem. Soc. Chem. Commun. , 295, (1974)
|
| 1,1',1''-Phosphoryltripyrrolidine |
| EINECS 229-118-2 |
| Tris(pyrrolidinophosphine) oxide |
| MFCD00014095 |
| Pyrrolidine, 1-(di-1-pyrrolidinylphosphinyl)- |