WAY-325484 structure
|
Common Name | WAY-325484 | ||
|---|---|---|---|---|
| CAS Number | 642002-74-2 | Molecular Weight | 266.34092 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 459.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5±28.7 °C | |
Use of WAY-325484CDK8 inhibitor; altering the lifespan of a eukaryotic organism; |
| Name | WAY-325484 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.1±45.0 °C at 760 mmHg |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.34092 |
| Flash Point | 231.5±28.7 °C |
| Exact Mass | 266.153137 |
| LogP | 4.03 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | GVNIOZQBNBBPNT-UHFFFAOYSA-N |
| SMILES | CCCc1nc(N)c(C#N)c(-c2cccnc2)c1CC |
| 2'-Amino-5'-ethyl-6'-propyl-3,4'-bipyridine-3'-carbonitrile |
| [3,4'-Bipyridine]-3'-carbonitrile, 2'-amino-5'-ethyl-6'-propyl- |