Boc-Onb structure
|
Common Name | Boc-Onb | ||
|---|---|---|---|---|
| CAS Number | 64205-15-8 | Molecular Weight | 279.289 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 360.9±52.0 °C at 760 mmHg | |
| Molecular Formula | C14H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.1±30.7 °C | |
| Name | tert-Butyl (1,3-dioxo-3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindol-2(3H)-yl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.9±52.0 °C at 760 mmHg |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.289 |
| Flash Point | 172.1±30.7 °C |
| Exact Mass | 279.110687 |
| PSA | 72.91000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | SMTQMXCDEUEZRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)ON1C(=O)C2C3C=CC(C3)C2C1=O |
| HS Code | 2925190090 |
|---|
|
~%
Boc-Onb CAS#:64205-15-8 |
| Literature: Synthesis, , # 2 p. 166 - 167 |
|
~%
Boc-Onb CAS#:64205-15-8 |
| Literature: Synthesis, , # 2 p. 166 - 167 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (1R,7S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}oxy)-4-azatricyclo[5.2.1.0]dec-8-ene-3,5-dione |
| 4-({[(2-Methyl-2-propanyl)oxy]carbonyl}oxy)-4-azatricyclo[5.2.1.0]dec-8-ene-3,5-dione |
| tert-butyloxycarbonyloxy-5-norbornene-2,3-dicarboximide |
| 4,7-Methano-1H-isoindole-1,3(2H)-dione, 2-[[(1,1-dimethylethoxy)carbonyl]oxy]-3a,4,7,7a-tetrahydro-, (4R,7S)- |
| 4,7-Methano-1H-isoindole-1,3(2H)-dione, 2-[[(1,1-dimethylethoxy)carbonyl]oxy]-3a,4,7,7a-tetrahydro- |