1,1'-(4-methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione structure
|
Common Name | 1,1'-(4-methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 6422-83-9 | Molecular Weight | 282.25100 | |
| Density | 1.506g/cm3 | Boiling Point | 511.8ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.4ºC | |
| Name | 1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 511.8ºC at 760 mmHg |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25100 |
| Flash Point | 253.4ºC |
| Exact Mass | 282.06400 |
| PSA | 74.76000 |
| LogP | 0.98380 |
| Index of Refraction | 1.685 |
| InChIKey | FJKKJQRXSPFNPM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)C=CC2=O)cc1N1C(=O)C=CC1=O |
| RIDADR | UN 2811 |
|---|---|
| Packaging Group | I |
| Hazard Class | 6.1(a) |
| HS Code | 2925190090 |
|
~%
1,1'-(4-methyl-... CAS#:6422-83-9 |
| Literature: US5994561 A1, ; |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
| N,N'-(4-Methyl-m-phenylene)dimaleimide |
| 2,4-Bis-(maleinimido)-toluol |
| 2,4-Dimaleimidotoluene |
| Toluene-2,4-bismaleimide |
| EINECS 229-175-3 |
| Bismaleimide,2,4-toluene |
| N,N'-2,4'-Tolylen-bis-maleimid |
| N,N'-2,4-Toluenebismaleimide |
| 2,4-bis(maleimido)toluene |
| N,N'-(4-Methyl-m-phenylen)-dimaleinsaeureimid |
| 1,1'-(4-methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione |
| 2,4-Tolylenebis(maleimide) |
| 1,3-Bismaleimide-4-methylbenzene |