2,4(1H,3H)-Pyrimidinedione,1-[(3a)-20-oxopregn-5-en-3-yl]- (9CI) structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,1-[(3a)-20-oxopregn-5-en-3-yl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 64226-67-1 | Molecular Weight | 410.54900 | |
| Density | 1.2g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H34N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)pyrimidine-2,4-dione |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.54900 |
| Exact Mass | 410.25700 |
| PSA | 71.93000 |
| LogP | 4.24570 |
| Index of Refraction | 1.592 |
| InChIKey | GPSPXQGHABLLTR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(n5ccc(=O)[nH]c5=O)CCC4(C)C3CCC12C |
|
~6%
2,4(1H,3H)-Pyri... CAS#:64226-67-1 |
| Literature: Autenrieth; Kan; Van Lier European Journal of Medicinal Chemistry, 1981 , vol. 16, # 6 p. 525 - 528 |
|
~%
2,4(1H,3H)-Pyri... CAS#:64226-67-1 |
| Literature: Autenrieth; Kan; Van Lier European Journal of Medicinal Chemistry, 1981 , vol. 16, # 6 p. 525 - 528 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |