Dracorhodin structure
|
Common Name | Dracorhodin | ||
|---|---|---|---|---|
| CAS Number | 643-56-1 | Molecular Weight | 266.29100 | |
| Density | 1.23g/cm3 | Boiling Point | 564.7ºC at 760 mmHg | |
| Molecular Formula | C17H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.1ºC | |
Use of DracorhodinDracorhodin, the main component in sanguis draconis, is a flavylium compound belonging to the anthocyanin family. Dracorhodin can induce vasodilatation[1]. |
| Name | 5-methoxy-6-methyl-2-phenylchromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Dracorhodin, the main component in sanguis draconis, is a flavylium compound belonging to the anthocyanin family. Dracorhodin can induce vasodilatation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 564.7ºC at 760 mmHg |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.29100 |
| Flash Point | 288.1ºC |
| Exact Mass | 266.09400 |
| PSA | 39.44000 |
| LogP | 3.72860 |
| Index of Refraction | 1.622 |
| InChIKey | UCZJPQIEFFTIEV-UHFFFAOYSA-N |
| SMILES | COc1c2ccc(-c3ccccc3)oc-2cc(=O)c1C |
| HS Code | 2914509090 |
|---|
|
~%
Dracorhodin CAS#:643-56-1 |
| Literature: Robertson; Whalley Journal of the Chemical Society, 1950 , p. 1882 |
|
~%
Dracorhodin CAS#:643-56-1 |
| Literature: Robertson; Whalley Journal of the Chemical Society, 1950 , p. 1882 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-Methoxy-6-methyl-2-phenyl-chromen-7-on |
| 5-methoxy-6-methyl-2-phenyl-chromen-7-one |
| 5-Methoxy-6-methyl-2-phenyl-7H-chromen-7-one |
| 7H-1-Benzopyran-7-one,5-methoxy-6-methyl-2-phenyl |
| 5-Methoxy-6-methyl-2-phenyl-7H-1-benzopyran-7-one |
| dracorhodin |
| 2-phenyl-5-methoxy-6-methyl-chromen-7-one |