Dracorhodin perchlorate structure
|
Common Name | Dracorhodin perchlorate | ||
|---|---|---|---|---|
| CAS Number | 125536-25-6 | Molecular Weight | 366.750 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15ClO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dracorhodin perchlorateDracorhodin perchlorate (Dracohodin perochlorate) is a natural product extracted from a natural medicine Dragon's blood. Dracorhodin perchlorate (Dracohodin perochlorate) inhibits cell proliferation, induces cell cycle arrest and apoptosis [1][2]. |
| Name | methane,5-methoxy-6-methyl-2-phenylchromenylium-7-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Dracorhodin perchlorate (Dracohodin perochlorate) is a natural product extracted from a natural medicine Dragon's blood. Dracorhodin perchlorate (Dracohodin perochlorate) inhibits cell proliferation, induces cell cycle arrest and apoptosis [1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H15ClO7 |
|---|---|
| Molecular Weight | 366.750 |
| Exact Mass | 366.050629 |
| PSA | 116.87000 |
| LogP | 4.61780 |
| InChIKey | KRTYZFUODYMZPG-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(O)cc2[o+]c(-c3ccccc3)ccc12.[O-][Cl+3]([O-])([O-])[O-] |
| Dracorhodin perochlorate |
| 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate |