(2-benzoyloxyphenyl) benzoate structure
|
Common Name | (2-benzoyloxyphenyl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 643-94-7 | Molecular Weight | 318.323 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 513.8±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8±23.8 °C | |
| Name | (2-benzoyloxyphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 513.8±33.0 °C at 760 mmHg |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.323 |
| Flash Point | 265.8±23.8 °C |
| Exact Mass | 318.089203 |
| PSA | 52.60000 |
| LogP | 4.61 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | LVTPRIAGCBEGPW-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1OC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| benzene-1,4-diyl dibenzoate |
| catechol dibenzoate |
| o-Phenylene dibenzoate |
| 1,2-Bis-benzoyloxy-benzol |
| 1,2-Benzenediol,dibenzoate |
| 1,2-Phenylene dibenzoate |
| benzene-1,2-diyl benzoate |
| 1,2-Benzenediol, dibenzoate |
| 1,2-Bis(benzoyloxy)benzene |
| 1,2-dibenzoyloxy benzene |