bis(4-propylphenyl)methanone
bis(4-propylphenyl)methanone structure
|
Common Name | bis(4-propylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 64357-93-3 | Molecular Weight | 266.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(4-propylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H22O |
|---|---|
| Molecular Weight | 266.37700 |
| Exact Mass | 266.16700 |
| PSA | 17.07000 |
| LogP | 4.82260 |
| InChIKey | SGHULJPBROKGMF-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(C(=O)c2ccc(CCC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis(4-propylphe... CAS#:64357-93-3 |
| Literature: Muraoka,M. et al. Chemical and Pharmaceutical Bulletin, 1960 , vol. 8, p. 860 - 866 |
|
~%
bis(4-propylphe... CAS#:64357-93-3 |
| Literature: Xuong; Buu-Hoi Journal of the Chemical Society, 1952 , p. 3741,3744 |
|
~%
bis(4-propylphe... CAS#:64357-93-3 |
| Literature: Fahim Journal of the Chemical Society, 1949 , p. 520 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-Dipropyl-benzophenon |
| 4,4'-dipropyl-benzophenone |
| 4,4'-di-n-propylbenzophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does bis(4-propylphenyl)methanone have? |
| A: English synonyms of bis(4-propylphenyl)methanone: 4,4'-Dipropyl-benzophenon, 4,4'-dipropyl-benzophenone, 4,4'-di-n-propylbenzophenone. |
| Q: What is the SMILES notation of bis(4-propylphenyl)methanone? |
| A: SMILES notation of bis(4-propylphenyl)methanone is CCCc1ccc(C(=O)c2ccc(CCC)cc2)cc1. |
| Q: What is the Chinese name of 64357-93-3? |
| A: Chinese name of 64357-93-3 is 64357-93-3. |
| Q: What is the molecular weight of bis(4-propylphenyl)methanone? |
| A: Molecular weight of bis(4-propylphenyl)methanone is 266.37700. |
| Q: What is the CAS number of bis(4-propylphenyl)methanone? |
| A: CAS number of bis(4-propylphenyl)methanone is 64357-93-3. |
| Q: What is the polar surface area (PSA) of bis(4-propylphenyl)methanone? |
| A: Polar surface area (PSA) of bis(4-propylphenyl)methanone is 17.07000. |
| Q: What is the InChIKey of bis(4-propylphenyl)methanone? |
| A: InChIKey of bis(4-propylphenyl)methanone is SGHULJPBROKGMF-UHFFFAOYSA-N. |
| Q: What is the LogP of bis(4-propylphenyl)methanone? |
| A: LogP of bis(4-propylphenyl)methanone is 4.82260. |
| Q: What is the molecular formula of bis(4-propylphenyl)methanone? |
| A: Molecular formula of bis(4-propylphenyl)methanone is C19H22O. |
| Q: What is the English name of bis(4-propylphenyl)methanone? |
| A: The English name of bis(4-propylphenyl)methanone is bis(4-propylphenyl)methanone. |