4,5-Dichloro-2-octyl-isothiazolone structure
|
Common Name | 4,5-Dichloro-2-octyl-isothiazolone | ||
|---|---|---|---|---|
| CAS Number | 64359-81-5 | Molecular Weight | 282.230 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 322.6±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H17Cl2NOS | Melting Point | 36-40ºC | |
| MSDS | USA | Flash Point | 148.9±30.7 °C | |
| Name | 4,5-dichloro-2-n-octyl-3(2H)-isothiazolone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.6±52.0 °C at 760 mmHg |
| Melting Point | 36-40ºC |
| Molecular Formula | C11H17Cl2NOS |
| Molecular Weight | 282.230 |
| Flash Point | 148.9±30.7 °C |
| Exact Mass | 281.040802 |
| PSA | 50.24000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | PORQOHRXAJJKGK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCn1sc(Cl)c(Cl)c1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~56%
4,5-Dichloro-2-... CAS#:64359-81-5 |
| Literature: US2008/227986 A1, ; Page/Page column 3 ; |
|
~%
4,5-Dichloro-2-... CAS#:64359-81-5 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 14, p. 627 - 630 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3(2H)-Isothiazolone, 4,5-dichloro-2-octyl- |
| EINECS 264-843-8 |
| dcoit |
| MFCD04034673 |
| 4,5-Dichloro-2-n-octyl-4-isothiazolin-3-one |
| 4,5-Dichloro-2-n-octyl-3(2H)-isothiazolone (DCOIT) |
| 4,5-Dichloro-2-octyl-1,2-thiazol-3(2H)-one |
| 4,5-dichloro-2-octyl-1,2-thiazol-3-one |
| 4,5-Dichloro-2-octyl-isothiazolone |