benzyl N-(methyl-phenylmethoxycarbonyl-amino)-N-[3-(propan-2-ylcarbamoyl)propyl]carbamate structure
|
Common Name | benzyl N-(methyl-phenylmethoxycarbonyl-amino)-N-[3-(propan-2-ylcarbamoyl)propyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 64377-82-8 | Molecular Weight | 441.52000 | |
| Density | 1.174g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H31N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl N-methyl-N-[[4-oxo-4-(propan-2-ylamino)butyl]-phenylmethoxycarbonylamino]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.52000 |
| Exact Mass | 441.22600 |
| PSA | 88.18000 |
| LogP | 4.50450 |
| Index of Refraction | 1.558 |
| InChIKey | SEXFUJXJIXFKAF-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)CCCN(C(=O)OCc1ccccc1)N(C)C(=O)OCc1ccccc1 |
|
~%
benzyl N-(methy... CAS#:64377-82-8 |
| Literature: Beisler; Peng; Driscoll Journal of Pharmaceutical Sciences, 1977 , vol. 66, # 6 p. 849 - 852 |
|
~%
benzyl N-(methy... CAS#:64377-82-8 |
| Literature: Beisler; Peng; Driscoll Journal of Pharmaceutical Sciences, 1977 , vol. 66, # 6 p. 849 - 852 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis(phenylmethyl)-1-methyl-2{4-[(1-methylethyl)amino]-4-oxobutyl}-1,2-hydrazindicarboxylat |
| BENZYL N-(METHYL-PHENYLMETHOXYCARBONYL-AMINO)-N-[3-(PROPAN-2-YLCARBAMOYL)PROPYL]CARBAMATE |