2,4-bis(aziridin-1-yl)-6-phenyl-1,3,5-triazine structure
|
Common Name | 2,4-bis(aziridin-1-yl)-6-phenyl-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 64398-66-9 | Molecular Weight | 239.27600 | |
| Density | 1.387g/cm3 | Boiling Point | 466.8ºC at 760mmHg | |
| Molecular Formula | C13H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | 2,4-bis(aziridin-1-yl)-6-phenyl-1,3,5-triazine |
|---|
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 466.8ºC at 760mmHg |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.27600 |
| Flash Point | 236.1ºC |
| Exact Mass | 239.11700 |
| PSA | 44.69000 |
| LogP | 1.30860 |
| Index of Refraction | 1.705 |
| InChIKey | MCAQHJDTRRSXJP-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nc(N3CC3)nc(N3CC3)n2)cc1 |
|
~%
2,4-bis(aziridi... CAS#:64398-66-9 |
| Literature: Schaefer et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5918,5921 |
|
~%
2,4-bis(aziridi... CAS#:64398-66-9 |
| Literature: Schaefer et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5918,5921 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |