dimetilan structure
|
Common Name | dimetilan | ||
|---|---|---|---|---|
| CAS Number | 644-64-4 | Molecular Weight | 240.25900 | |
| Density | 1.2g/cm3 | Boiling Point | 200~210(1.73kPa) | |
| Molecular Formula | C10H16N4O3 | Melting Point | 68-71ºC | |
| MSDS | Chinese USA | Flash Point | 70 °F | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimetilan |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 200~210(1.73kPa) |
| Melting Point | 68-71ºC |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.25900 |
| Flash Point | 70 °F |
| Exact Mass | 240.12200 |
| PSA | 67.67000 |
| LogP | 0.78160 |
| Index of Refraction | 1.547 |
| InChIKey | RDBIYWSVMRVKSG-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(=O)N(C)C)nn1C(=O)N(C)C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Phrases | 21-25-50/53 |
| Safety Phrases | 36/37-45-60-61 |
| RIDADR | 2757 |
| WGK Germany | 3 |
| RTECS | EZ9084000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2933199011 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933199011 |
|---|---|
| Summary | 2933199011 2-methoxy-6-pentylcyclohexa-2,5-diene-1,4-dione。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
This table lists relevant public references with title, journal and publication metadata for this compound.
|
[Comparative effectiveness of 2 types of baits for synanthropic flies in different regions].
Med. Parazitol. (Mosk.) 52(1) , 60-3, (1983)
|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Snip Fly |
| 1-Dimethylcarbamoyl-3-dimethylcarbamoyloxy-5-methylpyrazol |
| Snip fly bands |
| RCRA waste no. P191 |
| DIMETILAN |
| Dimetilane |
| [1-(dimethylcarbamoyl)-5-methylpyrazol-3-yl] N,N-dimethylcarbamate |
| 3-dimethylcarbamoyloxy-5-methyl-pyrazole-1-carboxylic acid dimethylamide |
| 1-dimethylcarbamoyl-5-methyl-3-pyrazolyl dimethylcarbamate |
| FLY Bands |
| MFCD00078688 |
| 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl N,N-dimethylcarbamate |
| 1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate |
| 1-dimethylcarbamoyl-5-methylpyrazol-3-yl-dimethylcarbamate |
| 1-(dimethylcarbamoyl)-5-methyl-1H-pyrazol-3-yl dimethylcarbamate |
| EINECS 211-420-0 |
| Caswell No. 496B |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of dimetilan? |
| A: Molecular weight of dimetilan is 240.25900. |
| Q: What is the SMILES notation of dimetilan? |
| A: SMILES notation of dimetilan is Cc1cc(OC(=O)N(C)C)nn1C(=O)N(C)C. |
| Q: What is the molecular formula of dimetilan? |
| A: Molecular formula of dimetilan is C10H16N4O3. |
| Q: What is the English name of dimetilan? |
| A: The English name of dimetilan is dimetilan. |
| Q: What is the InChIKey of dimetilan? |
| A: InChIKey of dimetilan is RDBIYWSVMRVKSG-UHFFFAOYSA-N. |
| Q: What are the downstream products of dimetilan? |
| A: Related downstream products(CAS) of dimetilan: 124-38-9;4344-87-0;124-40-3. |
| Q: What is the polar surface area (PSA) of dimetilan? |
| A: Polar surface area (PSA) of dimetilan is 67.67000. |
| Q: What is the boiling point of dimetilan? |
| A: Boiling point of dimetilan is 200~210(1.73kPa). |
| Q: What is the LogP of dimetilan? |
| A: LogP of dimetilan is 0.78160. |
| Q: What is the melting point of dimetilan? |
| A: Melting point of dimetilan is 68-71ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |