(2-hydroxyphenyl)-(2-methylpyrimidin-5-yl)methanone structure
|
Common Name | (2-hydroxyphenyl)-(2-methylpyrimidin-5-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 64469-21-2 | Molecular Weight | 214.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-hydroxyphenyl)-(2-methylpyrimidin-5-yl)methanone |
|---|
| Molecular Formula | C12H10N2O2 |
|---|---|
| Molecular Weight | 214.22000 |
| Exact Mass | 214.07400 |
| PSA | 63.08000 |
| LogP | 1.72160 |
| InChIKey | RGGLDTVWLPCGOJ-UHFFFAOYSA-N |
| SMILES | Cc1ncc(C(=O)c2ccccc2O)cn1 |
|
~75%
(2-hydroxypheny... CAS#:64469-21-2 |
| Literature: Pene, Cecile; Hubert-Habart, Michel Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 329 - 332 |
|
~%
(2-hydroxypheny... CAS#:64469-21-2 |
| Literature: Pene, Cecile; Hubert-Habart, Michel Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 329 - 332 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |