CAS# 61466-16-8 structure
|
Common Name | CAS# 61466-16-8 | ||
|---|---|---|---|---|
| CAS Number | 61466-16-8 | Molecular Weight | 214.22000 | |
| Density | 1.365g/cm3 | Boiling Point | 436.4ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8ºC | |
| Name | 2-methyl-5H-chromeno[4,3-d]pyrimidin-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 436.4ºC at 760 mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 217.8ºC |
| Exact Mass | 214.07400 |
| PSA | 55.24000 |
| LogP | 1.83530 |
| Index of Refraction | 1.661 |
| InChIKey | FTKVCKDRRWZYFF-UHFFFAOYSA-N |
| SMILES | Cc1ncc2c(n1)-c1ccccc1OC2O |
|
~0%
CAS# 61466-16-8 CAS#:61466-16-8 |
| Literature: Pene, Cecile; Hubert-Habart, Michel Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 329 - 332 |
|
~%
CAS# 61466-16-8 CAS#:61466-16-8 |
| Literature: Pene, Cecile; Hubert-Habart, Michel Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 329 - 332 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Methyl-5H-chromeno(4,3-d)pyrimidin-5-ol |