1H-Isoindole-1,3(2H)-dione, 2-[(2,4,6-trimethylphenyl)methyl]- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione, 2-[(2,4,6-trimethylphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 64489-90-3 | Molecular Weight | 279.33300 | |
| Density | 1.216g/cm3 | Boiling Point | 436.3ºC at 760mmHg | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | 2-[(2,4,6-trimethylphenyl)methyl]isoindole-1,3-dione |
|---|
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760mmHg |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.33300 |
| Flash Point | 191.9ºC |
| Exact Mass | 279.12600 |
| PSA | 37.38000 |
| LogP | 3.34590 |
| Index of Refraction | 1.625 |
| InChIKey | NBYNEQBMCUMTLI-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(CN2C(=O)c3ccccc3C2=O)c(C)c1 |
|
~%
1H-Isoindole-1,... CAS#:64489-90-3 |
| Literature: Fuson; Denton Journal of the American Chemical Society, 1941 , vol. 63, p. 654 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |