CHEMBRDG-BB 5222291 structure
|
Common Name | CHEMBRDG-BB 5222291 | ||
|---|---|---|---|---|
| CAS Number | 64500-19-2 | Molecular Weight | 212.63300 | |
| Density | 1.347g/cm3 | Boiling Point | 419.2ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
| Name | N-(5-chloro-2-pyridyl)-3-oxobutanamide |
|---|
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 419.2ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.63300 |
| Flash Point | 207.3ºC |
| Exact Mass | 212.03500 |
| PSA | 59.06000 |
| LogP | 1.72560 |
| Index of Refraction | 1.583 |
| InChIKey | UEZASIMGDHJPTD-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1ccc(Cl)cn1 |
| HS Code | 2933399090 |
|---|
|
~93%
CHEMBRDG-BB 5222291 CAS#:64500-19-2 |
| Literature: Suri; Satti Synthetic Communications, 2000 , vol. 30, # 20 p. 3709 - 3718 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |