1-(4-nitrophenoxy)-3-(4-phenylpiperidin-1-yl)propan-2-ol structure
|
Common Name | 1-(4-nitrophenoxy)-3-(4-phenylpiperidin-1-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 64511-67-7 | Molecular Weight | 356.41600 | |
| Density | 1.212g/cm3 | Boiling Point | 547.3ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.8ºC | |
| Name | 1-(4-nitrophenoxy)-3-(4-phenylpiperidin-1-yl)propan-2-ol |
|---|
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 547.3ºC at 760 mmHg |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.41600 |
| Flash Point | 284.8ºC |
| Exact Mass | 356.17400 |
| PSA | 78.52000 |
| LogP | 3.67520 |
| Index of Refraction | 1.59 |
| InChIKey | GGTZXTPZXLFXLI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCC(O)CN2CCC(c3ccccc3)CC2)cc1 |
|
~83%
1-(4-nitropheno... CAS#:64511-67-7 |
| Literature: Connors, Sean P.; Dennis, Paul D.; Gill, Edward W.; Terrar, Derek A. Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1570 - 1577 |
|
~%
1-(4-nitropheno... CAS#:64511-67-7 |
| Literature: Connors, Sean P.; Dennis, Paul D.; Gill, Edward W.; Terrar, Derek A. Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1570 - 1577 |