5-[tert-butyl(diphenyl)silyl]oxy-4-fluoropentan-1-ol structure
|
Common Name | 5-[tert-butyl(diphenyl)silyl]oxy-4-fluoropentan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 645413-04-3 | Molecular Weight | 360.53800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H29FO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[tert-butyl(diphenyl)silyl]oxy-4-fluoropentan-1-ol |
|---|
| Molecular Formula | C21H29FO2Si |
|---|---|
| Molecular Weight | 360.53800 |
| Exact Mass | 360.19200 |
| PSA | 29.46000 |
| LogP | 3.67360 |
| InChIKey | OWPOFNRJGWMZPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](OCC(F)CCCO)(c1ccccc1)c1ccccc1 |
|
~81%
5-[tert-butyl(d... CAS#:645413-04-3 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |
|
~%
5-[tert-butyl(d... CAS#:645413-04-3 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |