5-[tert-butyl(diphenyl)silyl]oxy-4-fluoropentanal structure
|
Common Name | 5-[tert-butyl(diphenyl)silyl]oxy-4-fluoropentanal | ||
|---|---|---|---|---|
| CAS Number | 645413-05-4 | Molecular Weight | 358.52200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27FO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[tert-butyl(diphenyl)silyl]oxy-4-fluoropentanal |
|---|
| Molecular Formula | C21H27FO2Si |
|---|---|
| Molecular Weight | 358.52200 |
| Exact Mass | 358.17600 |
| PSA | 26.30000 |
| LogP | 3.88020 |
| InChIKey | COFRSKIXSCGYPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](OCC(F)CCC=O)(c1ccccc1)c1ccccc1 |
|
~92%
5-[tert-butyl(d... CAS#:645413-05-4 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |
|
~%
5-[tert-butyl(d... CAS#:645413-05-4 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |
|
~%
5-[tert-butyl(d... CAS#:645413-05-4 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |