Acantrifoside E structure
|
Common Name | Acantrifoside E | ||
|---|---|---|---|---|
| CAS Number | 645414-25-1 | Molecular Weight | 356.37 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 574.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H24O8 | Melting Point | 178-180℃ | |
| MSDS | N/A | Flash Point | 301.4±30.1 °C | |
Use of Acantrifoside EAcantrifoside E (Compound 8) is a nature compound. Acantrifoside E can be isolated from the 90% ethanol extract of Salacia cochinchinensis. Acantrifoside E has none α-glucosidase inhibitory activity[1]. |
| Name | (2S,3R,4S,5S,6R)-2-(2,6-dimethoxy-4-((E)-prop-1-en-1-yl)phenoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | Acantrifoside E (Compound 8) is a nature compound. Acantrifoside E can be isolated from the 90% ethanol extract of Salacia cochinchinensis. Acantrifoside E has none α-glucosidase inhibitory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.8±50.0 °C at 760 mmHg |
| Melting Point | 178-180℃ |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 |
| Flash Point | 301.4±30.1 °C |
| Exact Mass | 356.147125 |
| PSA | 117.84000 |
| LogP | -0.41 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | ZDLGCAQIENQSSF-UHFFFAOYSA-N |
| SMILES | CC=Cc1cc(OC)c(OC2OC(CO)C(O)C(O)C2O)c(OC)c1 |
| Hazard Codes | Xi |
|---|
| 2,6-Dimethoxy-4-[(1E)-1-propen-1-yl]phenyl β-D-glucopyranoside |
| β-D-Glucopyranoside, 2,6-dimethoxy-4-[(1E)-1-propen-1-yl]phenyl |