N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]benzenesulfonamide structure
|
Common Name | N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6458-66-8 | Molecular Weight | 332.37400 | |
| Density | 1.34g/cm3 | Boiling Point | 497ºC at 760mmHg | |
| Molecular Formula | C16H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]benzenesulfonamide |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 497ºC at 760mmHg |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.37400 |
| Flash Point | 254.4ºC |
| Exact Mass | 332.08300 |
| PSA | 85.37000 |
| LogP | 3.63200 |
| Index of Refraction | 1.624 |
| InChIKey | AEPONBGLDZUAGO-SFQUDFHCSA-N |
| SMILES | CC(=NNS(=O)(=O)c1ccccc1)c1ccc2c(c1)OCCO2 |
|
~%
N-[(E)-1-(2,3-d... CAS#:6458-66-8 |
| Literature: Sycheva,T.P. et al. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1966 , vol. 2, p. 144 - 148 Khimiya Geterotsiklicheskikh Soedinenii, 1966 , vol. 2, p. 205 - 211 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |